C21H24N3+ — CID 135085089
(5S)-5-benzyl-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium (PubChem CID 135085089) has the molecular formula C21H24N3+ and a molecular weight of 318.44 g/mol. Its IUPAC name is (5S)-5-benzyl-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium.
| Compound Name | (5S)-5-benzyl-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium |
|---|---|
| PubChem CID | 135085089 |
| Molecular Formula | C21H24N3+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (5S)-5-benzyl-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium |
| SMILES | Cc1cc(C)c(-n2c[n+]3c(n2)CC[C@H]3Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H24N3/c1-15-11-16(2)21(17(3)12-15)24-14-23-19(9-10-20(23)22-24)13-18-7-5-4-6-8-18/h4-8,11-12,14,19H,9-10,13H2,1-3H3/q+1/t19-/m0/s1 |
| InChIKey | LLPYXFAFVSCQRV-IBGZPJMESA-N |
| XLogP | 3.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|