C18H26N3+ — CID 170920553
5-tert-butyl-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium (PubChem CID 170920553) has the molecular formula C18H26N3+ and a molecular weight of 284.43 g/mol. Its IUPAC name is 5-tert-butyl-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium.
| Compound Name | 5-tert-butyl-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium |
|---|---|
| PubChem CID | 170920553 |
| Molecular Formula | C18H26N3+ |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 5-tert-butyl-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium |
| SMILES | Cc1cc(C)c(-n2c[n+]3c(n2)CCC3C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C18H26N3/c1-12-9-13(2)17(14(3)10-12)21-11-20-15(18(4,5)6)7-8-16(20)19-21/h9-11,15H,7-8H2,1-6H3/q+1 |
| InChIKey | XOJYDVGTPSJTDL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|