C31H38N3OSi+ — CID 122212995
tert-butyl-diphenyl-[[(5S)-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methoxy]silane (PubChem CID 122212995) has the molecular formula C31H38N3OSi+ and a molecular weight of 496.75 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(5S)-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(5S)-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methoxy]silane |
|---|---|
| PubChem CID | 122212995 |
| Molecular Formula | C31H38N3OSi+ |
| Molecular Weight | 496.75 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | tert-butyl-diphenyl-[[(5S)-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methoxy]silane |
| SMILES | Cc1cc(C)c(-n2c[n+]3c(n2)CC[C@H]3CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C31H38N3OSi/c1-23-19-24(2)30(25(3)20-23)34-22-33-26(17-18-29(33)32-34)21-35-36(31(4,5)6,27-13-9-7-10-14-27)28-15-11-8-12-16-28/h7-16,19-20,22,26H,17-18,21H2,1-6H3/q+1/t26-/m0/s1 |
| InChIKey | HVQJBLUDDACHLZ-SANMLTNESA-N |
| XLogP | 5.15 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.75 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|