C32H34N6+2 — CID 166440774
(5S)-5-benzyl-2-[3-[(5S)-5-benzyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-4-ium-2-yl]phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-4-ium (PubChem CID 166440774) has the molecular formula C32H34N6+2 and a molecular weight of 502.67 g/mol. Its IUPAC name is (5S)-5-benzyl-2-[3-[(5S)-5-benzyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-4-ium-2-yl]phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-4-ium.
| Compound Name | (5S)-5-benzyl-2-[3-[(5S)-5-benzyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-4-ium-2-yl]phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-4-ium |
|---|---|
| PubChem CID | 166440774 |
| Molecular Formula | C32H34N6+2 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | (5S)-5-benzyl-2-[3-[(5S)-5-benzyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-4-ium-2-yl]phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-4-ium |
| SMILES | c1ccc(C[C@@H]2CCCc3nn(-c4cccc(-n5c[n+]6c(n5)CCC[C@H]6Cc5ccccc5)c4)c[n+]32)cc1 |
| InChI | InChI=1S/C32H34N6/c1-3-10-25(11-4-1)20-27-14-8-18-31-33-37(23-35(27)31)29-16-7-17-30(22-29)38-24-36-28(15-9-19-32(36)34-38)21-26-12-5-2-6-13-26/h1-7,10-13,16-17,22-24,27-28H,8-9,14-15,18-21H2/q+2/t27-,28-/m0/s1 |
| InChIKey | YPICWVFODNPMFS-NSOVKSMOSA-N |
| XLogP | 4.87 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|