C18H15Cl3N3O+ — CID 146157458
5-benzyl-2-(2,4,6-trichlorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium (PubChem CID 146157458) has the molecular formula C18H15Cl3N3O+ and a molecular weight of 395.70 g/mol. Its IUPAC name is 5-benzyl-2-(2,4,6-trichlorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium.
| Compound Name | 5-benzyl-2-(2,4,6-trichlorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
|---|---|
| PubChem CID | 146157458 |
| Molecular Formula | C18H15Cl3N3O+ |
| Molecular Weight | 395.70 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 5-benzyl-2-(2,4,6-trichlorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
| SMILES | Clc1cc(Cl)c(-n2c[n+]3c(n2)COCC3Cc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl3N3O/c19-13-7-15(20)18(16(21)8-13)24-11-23-14(9-25-10-17(23)22-24)6-12-4-2-1-3-5-12/h1-5,7-8,11,14H,6,9-10H2/q+1 |
| InChIKey | IZEPRFBOGYCMBU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.70 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|