C26H28N2O3S — CID 57326649
2-[[(5S)-5-benzyl-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]methyl]benzenesulfonate (PubChem CID 57326649) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is 2-[[(5S)-5-benzyl-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]methyl]benzenesulfonate.
| Compound Name | 2-[[(5S)-5-benzyl-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 57326649 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-[[(5S)-5-benzyl-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-1-yl]methyl]benzenesulfonate |
| SMILES | Cc1cc(C)c(N2C=[N+](Cc3ccccc3S(=O)(=O)[O-])[C@@H](Cc3ccccc3)C2)c(C)c1 |
| InChI | InChI=1S/C26H28N2O3S/c1-19-13-20(2)26(21(3)14-19)28-17-24(15-22-9-5-4-6-10-22)27(18-28)16-23-11-7-8-12-25(23)32(29,30)31/h4-14,18,24H,15-17H2,1-3H3/t24-/m0/s1 |
| InChIKey | BRGGRVWDXOTHBW-DEOSSOPVSA-N |
| XLogP | 4.19 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|