C60H100N4Si2 — CID 139132579
N-[[2,6-di(propan-2-yl)anilino]-di(propan-2-yl)silyl]-2,6-di(propan-2-yl)aniline (PubChem CID 139132579) has the molecular formula C60H100N4Si2 and a molecular weight of 933.66 g/mol. Its IUPAC name is N-[[2,6-di(propan-2-yl)anilino]-di(propan-2-yl)silyl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[[2,6-di(propan-2-yl)anilino]-di(propan-2-yl)silyl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 139132579 |
| Molecular Formula | C60H100N4Si2 |
| Molecular Weight | 933.66 g/mol |
| Exact Mass | 932.75 |
| IUPAC Name | N-[[2,6-di(propan-2-yl)anilino]-di(propan-2-yl)silyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1N[Si](Nc1c(C(C)C)cccc1C(C)C)(C(C)C)C(C)C.CC(C)c1cccc(C(C)C)c1N[Si](Nc1c(C(C)C)cccc1C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/2C30H50N2Si/c2*1-19(2)25-15-13-16-26(20(3)4)29(25)31-33(23(9)10,24(11)12)32-30-27(21(5)6)17-14-18-28(30)22(7)8/h2*13-24,31-32H,1-12H3 |
| InChIKey | KEKRQBILLBMBSV-UHFFFAOYSA-N |
| XLogP | 19.93 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.66 |
| LogP ≤ 5 | 19.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|