C30H42N6O2 — CID 139083857
1-N,4-N-bis[2,6-di(propan-2-yl)phenyl]-3,6-dimethyl-1,2,4,5-tetrazine-1,4-dicarboxamide (PubChem CID 139083857) has the molecular formula C30H42N6O2 and a molecular weight of 518.71 g/mol. Its IUPAC name is 1-N,4-N-bis[2,6-di(propan-2-yl)phenyl]-3,6-dimethyl-1,2,4,5-tetrazine-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[2,6-di(propan-2-yl)phenyl]-3,6-dimethyl-1,2,4,5-tetrazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 139083857 |
| Molecular Formula | C30H42N6O2 |
| Molecular Weight | 518.71 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | 1-N,4-N-bis[2,6-di(propan-2-yl)phenyl]-3,6-dimethyl-1,2,4,5-tetrazine-1,4-dicarboxamide |
| SMILES | CC1=NN(C(=O)Nc2c(C(C)C)cccc2C(C)C)C(C)=NN1C(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C30H42N6O2/c1-17(2)23-13-11-14-24(18(3)4)27(23)31-29(37)35-21(9)34-36(22(10)33-35)30(38)32-28-25(19(5)6)15-12-16-26(28)20(7)8/h11-20H,1-10H3,(H,31,37)(H,32,38) |
| InChIKey | HWUWPALISNSKIY-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.71 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |