C24H27PS — CID 139122324
[2,6-di(propan-2-yl)phenyl]-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 139122324) has the molecular formula C24H27PS and a molecular weight of 378.52 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl]-diphenyl-sulfanylidene-λ5-phosphane.
| Compound Name | [2,6-di(propan-2-yl)phenyl]-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 139122324 |
| Molecular Formula | C24H27PS |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl]-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | CC(C)c1cccc(C(C)C)c1P(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27PS/c1-18(2)22-16-11-17-23(19(3)4)24(22)25(26,20-12-7-5-8-13-20)21-14-9-6-10-15-21/h5-19H,1-4H3 |
| InChIKey | LZGQXPAMPPNNGA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|