C46H53N2P — CID 175121682
[1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-2-yl]methylidene-triphenyl-λ5-phosphane (PubChem CID 175121682) has the molecular formula C46H53N2P and a molecular weight of 664.92 g/mol. Its IUPAC name is [1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-2-yl]methylidene-triphenyl-λ5-phosphane.
| Compound Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-2-yl]methylidene-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 175121682 |
| Molecular Formula | C46H53N2P |
| Molecular Weight | 664.92 g/mol |
| Exact Mass | 664.39 |
| IUPAC Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-2-yl]methylidene-triphenyl-λ5-phosphane |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C=CN(c2c(C(C)C)cccc2C(C)C)C1C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H53N2P/c1-33(2)40-26-18-27-41(34(3)4)45(40)47-30-31-48(46-42(35(5)6)28-19-29-43(46)36(7)8)44(47)32-49(37-20-12-9-13-21-37,38-22-14-10-15-23-38)39-24-16-11-17-25-39/h9-36,44H,1-8H3 |
| InChIKey | RROBCHPPFOBQPO-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.92 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|