C33H42CuN2O — CID 101393152
CID 101393152 (PubChem CID 101393152) has the molecular formula C33H42CuN2O and a molecular weight of 546.26 g/mol.
| Compound Name | CID 101393152 |
|---|---|
| PubChem CID | 101393152 |
| Molecular Formula | C33H42CuN2O |
| Molecular Weight | 546.26 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[CH]N(c2c(C(C)C)cccc2C(C)C)C=C1.[Cu+].[O-]c1ccccc1 |
| InChI | InChI=1S/C27H37N2.C6H6O.Cu/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;7-6-4-2-1-3-5-6;/h9-21H,1-8H3;1-5,7H;/q;;+1/p-1 |
| InChIKey | XEMIUHIQEZSUON-UHFFFAOYSA-M |
| XLogP | 8.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.26 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |