C40H50BN2P — CID 139168157
[[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]methyl-diphenylphosphaniumyl]boranuide (PubChem CID 139168157) has the molecular formula C40H50BN2P and a molecular weight of 600.64 g/mol. Its IUPAC name is [[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]methyl-diphenylphosphaniumyl]boranuide.
| Compound Name | [[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]methyl-diphenylphosphaniumyl]boranuide |
|---|---|
| PubChem CID | 139168157 |
| Molecular Formula | C40H50BN2P |
| Molecular Weight | 600.64 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | [[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]methyl-diphenylphosphaniumyl]boranuide |
| SMILES | [BH3-][P+](C=C1N(c2c(C(C)C)cccc2C(C)C)C=CN1c1c(C(C)C)cccc1C(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H50BN2P/c1-28(2)34-21-15-22-35(29(3)4)39(34)42-25-26-43(40-36(30(5)6)23-16-24-37(40)31(7)8)38(42)27-44(41,32-17-11-9-12-18-32)33-19-13-10-14-20-33/h9-31H,1-8,41H3 |
| InChIKey | VQRWZTHUAPCQQC-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.64 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|