C56H74GeI2N4 — CID 177405397
bis[[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]methyl]-diiodogermane (PubChem CID 177405397) has the molecular formula C56H74GeI2N4 and a molecular weight of 1129.65 g/mol. Its IUPAC name is bis[[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]methyl]-diiodogermane.
| Compound Name | bis[[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]methyl]-diiodogermane |
|---|---|
| PubChem CID | 177405397 |
| Molecular Formula | C56H74GeI2N4 |
| Molecular Weight | 1129.65 g/mol |
| Exact Mass | 1130.32 |
| IUPAC Name | bis[[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]methyl]-diiodogermane |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C=CN(c2c(C(C)C)cccc2C(C)C)C1=C[Ge](I)(I)C=C1N(c2c(C(C)C)cccc2C(C)C)C=CN1c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C56H74GeI2N4/c1-35(2)43-21-17-22-44(36(3)4)53(43)60-29-30-61(54-45(37(5)6)23-18-24-46(54)38(7)8)51(60)33-57(58,59)34-52-62(55-47(39(9)10)25-19-26-48(55)40(11)12)31-32-63(52)56-49(41(13)14)27-20-28-50(56)42(15)16/h17-42H,1-16H3 |
| InChIKey | ZXZQMMGDGLSQFA-UHFFFAOYSA-N |
| XLogP | 18.04 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1129.65 |
| LogP ≤ 5 | 18.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|