About CID 172510893
CID 172510893 (PubChem CID 172510893) has the molecular formula C45H44N3O3
and a molecular weight of 674.87 g/mol.
Molecular Properties
| Compound Name | CID 172510893 |
| PubChem CID | 172510893 |
| Molecular Formula | C45H44N3O3 |
| Molecular Weight | 674.87 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C=CN(c2c(C(C)C)cccc2C(C)C)[C]1c1cc2c3c(c1)Oc1cccc4c1N3c1c(cccc1O2)O4 |
| InChI | InChI=1S/C45H44N3O3/c1-25(2)30-13-9-14-31(26(3)4)40(30)46-21-22-47(41-32(27(5)6)15-10-16-33(41)28(7)8)45(46)29-23-38-44-39(24-29)51-37-20-12-18-35-43(37)48(44)42-34(49-35)17-11-19-36(42)50-38/h9-28H,1-8H3 |
| InChIKey | QAJDRJPEYWTJGU-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 674.87 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 172510893 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172510893?
The IUPAC name of CID 172510893 (CID 172510893) is not available.
What is the SMILES notation for CID 172510893?
The canonical SMILES for CID 172510893 is CC(C)c1cccc(C(C)C)c1N1C=CN(c2c(C(C)C)cccc2C(C)C)[C]1c1cc2c3c(c1)Oc1cccc4c1N3c1c(cccc1O2)O4.
What is the InChIKey of CID 172510893?
The InChIKey is QAJDRJPEYWTJGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H44N3O3/c1-25(2)30-13-9-14-31(26(3)4)40(30)46-21-22-47(41-32(27(5)6)15-10-16-33(41)28(7)8)45(46)29-23-38-44-39(24-29)51-37-20-12-18-35-43(37)48(44)42-34(49-35)17-11-19-36(42)50-38/h9-28H,1-8H3.
What are the key properties of CID 172510893?
CID 172510893 has a molecular weight of 674.87 g/mol, XLogP of 13.30, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172510893 is sourced from PubChem (CID 172510893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).