C40H45N2O2 — CID 172510816
CID 172510816 (PubChem CID 172510816) has the molecular formula C40H45N2O2 and a molecular weight of 585.81 g/mol.
| Compound Name | CID 172510816 |
|---|---|
| PubChem CID | 172510816 |
| Molecular Formula | C40H45N2O2 |
| Molecular Weight | 585.81 g/mol |
| Exact Mass | 585.35 |
| IUPAC Name | — |
| SMILES | CCC1(CC)CC(C)(C)N(c2c(C(C)C)cccc2C(C)C)[C]1c1cc2c3c(c1)Oc1ccccc1N3c1ccccc1O2 |
| InChI | InChI=1S/C40H45N2O2/c1-9-40(10-2)24-39(7,8)42(36-28(25(3)4)16-15-17-29(36)26(5)6)38(40)27-22-34-37-35(23-27)44-33-21-14-12-19-31(33)41(37)30-18-11-13-20-32(30)43-34/h11-23,25-26H,9-10,24H2,1-8H3 |
| InChIKey | FEYMUUODSQRUCR-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.81 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |