C46H57BN — CID 172510719
CID 172510719 (PubChem CID 172510719) has the molecular formula C46H57BN and a molecular weight of 634.78 g/mol.
| Compound Name | CID 172510719 |
|---|---|
| PubChem CID | 172510719 |
| Molecular Formula | C46H57BN |
| Molecular Weight | 634.78 g/mol |
| Exact Mass | 634.46 |
| IUPAC Name | — |
| SMILES | CCC1(CC)CC(C)(C)N(c2c(C(C)C)cccc2C(C)C)[C]1c1cc2c3c(c1)C(C)(C)c1ccccc1B3c1ccccc1C2(C)C |
| InChI | InChI=1S/C46H57BN/c1-13-46(14-2)28-43(7,8)48(41-32(29(3)4)20-19-21-33(41)30(5)6)42(46)31-26-36-40-37(27-31)45(11,12)35-23-16-18-25-39(35)47(40)38-24-17-15-22-34(38)44(36,9)10/h15-27,29-30H,13-14,28H2,1-12H3 |
| InChIKey | GYFQNOKVBHDXGS-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.78 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|