C58H57N2 — CID 172510748
CID 172510748 (PubChem CID 172510748) has the molecular formula C58H57N2 and a molecular weight of 782.11 g/mol.
| Compound Name | CID 172510748 |
|---|---|
| PubChem CID | 172510748 |
| Molecular Formula | C58H57N2 |
| Molecular Weight | 782.11 g/mol |
| Exact Mass | 781.45 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C](c2ccc(N(c3ccc4c(c3)-c3ccccc3C4(C)C)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C58H57N2/c1-36(2)42-21-17-22-43(37(3)4)55(42)60-54(47-20-13-16-25-52(47)58(60,9)10)38-26-28-39(29-27-38)59(40-31-33-51-48(34-40)45-19-12-15-24-50(45)56(51,5)6)41-30-32-46-44-18-11-14-23-49(44)57(7,8)53(46)35-41/h11-37H,1-10H3 |
| InChIKey | VFUMJIWQSZHPGE-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.11 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |