C62H62N5 — CID 172510642
CID 172510642 (PubChem CID 172510642) has the molecular formula C62H62N5 and a molecular weight of 877.21 g/mol.
| Compound Name | CID 172510642 |
|---|---|
| PubChem CID | 172510642 |
| Molecular Formula | C62H62N5 |
| Molecular Weight | 877.21 g/mol |
| Exact Mass | 876.50 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C](c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)N(c2c(C(C)C)cccc2C(C)C)c2nccnc21 |
| InChI | InChI=1S/C62H62N5/c1-39(2)49-21-16-22-50(40(3)4)57(49)66-59-60(64-37-36-63-59)67(58-51(41(5)6)23-17-24-52(58)42(7)8)61(66)45-28-32-47(33-29-45)65(46-30-26-44(27-31-46)43-18-12-11-13-19-43)48-34-35-54-53-20-14-15-25-55(53)62(9,10)56(54)38-48/h11-42H,1-10H3 |
| InChIKey | SNXUBYIFWNJMTO-UHFFFAOYSA-N |
| XLogP | 17.24 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.21 |
| LogP ≤ 5 | 17.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |