About CID 172510821
CID 172510821 (PubChem CID 172510821) has the molecular formula C58H56N3
and a molecular weight of 795.11 g/mol.
Molecular Properties
| Compound Name | CID 172510821 |
| PubChem CID | 172510821 |
| Molecular Formula | C58H56N3 |
| Molecular Weight | 795.11 g/mol |
| Exact Mass | 794.45 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C=CN(c2c(C(C)C)cccc2C(C)C)[C]1c1ccc(N2c3ccccc3C3(c4ccccc4-c4ccccc43)c3ccccc32)cc1 |
| InChI | InChI=1S/C58H56N3/c1-37(2)43-21-17-22-44(38(3)4)55(43)59-35-36-60(56-45(39(5)6)23-18-24-46(56)40(7)8)57(59)41-31-33-42(34-32-41)61-53-29-15-13-27-51(53)58(52-28-14-16-30-54(52)61)49-25-11-9-19-47(49)48-20-10-12-26-50(48)58/h9-40H,1-8H3 |
| InChIKey | BNPZGFQXPFHFFR-UHFFFAOYSA-N |
| XLogP | 15.66 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 795.11 |
| LogP ≤ 5 | 15.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 172510821 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172510821?
The IUPAC name of CID 172510821 (CID 172510821) is not available.
What is the SMILES notation for CID 172510821?
The canonical SMILES for CID 172510821 is CC(C)c1cccc(C(C)C)c1N1C=CN(c2c(C(C)C)cccc2C(C)C)[C]1c1ccc(N2c3ccccc3C3(c4ccccc4-c4ccccc43)c3ccccc32)cc1.
What is the InChIKey of CID 172510821?
The InChIKey is BNPZGFQXPFHFFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C58H56N3/c1-37(2)43-21-17-22-44(38(3)4)55(43)59-35-36-60(56-45(39(5)6)23-18-24-46(56)40(7)8)57(59)41-31-33-42(34-32-41)61-53-29-15-13-27-51(53)58(52-28-14-16-30-54(52)61)49-25-11-9-19-47(49)48-20-10-12-26-50(48)58/h9-40H,1-8H3.
What are the key properties of CID 172510821?
CID 172510821 has a molecular weight of 795.11 g/mol, XLogP of 15.66, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172510821 is sourced from PubChem (CID 172510821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).