About CID 177428700
CID 177428700 (PubChem CID 177428700) has the molecular formula C27H31N2OP
and a molecular weight of 430.53 g/mol.
Molecular Properties
| Compound Name | CID 177428700 |
| PubChem CID | 177428700 |
| Molecular Formula | C27H31N2OP |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C]N(P(=O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H31N2OP/c1-21(2)25-16-11-17-26(22(3)4)27(25)28-18-19-29(20-28)31(30,23-12-7-5-8-13-23)24-14-9-6-10-15-24/h5-17,21-22H,18-19H2,1-4H3 |
| InChIKey | ZILYGHIQOQEWJS-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 177428700 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177428700?
The IUPAC name of CID 177428700 (CID 177428700) is not available.
What is the SMILES notation for CID 177428700?
The canonical SMILES for CID 177428700 is CC(C)c1cccc(C(C)C)c1N1[C]N(P(=O)(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of CID 177428700?
The InChIKey is ZILYGHIQOQEWJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31N2OP/c1-21(2)25-16-11-17-26(22(3)4)27(25)28-18-19-29(20-28)31(30,23-12-7-5-8-13-23)24-14-9-6-10-15-24/h5-17,21-22H,18-19H2,1-4H3.
What are the key properties of CID 177428700?
CID 177428700 has a molecular weight of 430.53 g/mol, XLogP of 5.98, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177428700 is sourced from PubChem (CID 177428700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).