About CID 139241153
CID 139241153 (PubChem CID 139241153) has the molecular formula C60H63Cl2N2PRu
and a molecular weight of 1015.13 g/mol.
Molecular Properties
| Compound Name | CID 139241153 |
| PubChem CID | 139241153 |
| Molecular Formula | C60H63Cl2N2PRu |
| Molecular Weight | 1015.13 g/mol |
| Exact Mass | 1014.31 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C]N(c2c(C(C)C)cccc2C(C)C)CC1.Cl[Ru](Cl)=C1C=C(c2ccccc2)c2ccccc21.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H38N2.C18H15P.C15H10.2ClH.Ru/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)15;;;/h9-14,18-21H,15-16H2,1-8H3;1-15H;1-9,11H;2*1H;/q;;;;;+2/p-2 |
| InChIKey | GZMFTHPVQNQPPT-UHFFFAOYSA-L |
| XLogP | 15.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1015.13 |
| LogP ≤ 5 | 15.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 139241153 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139241153?
The IUPAC name of CID 139241153 (CID 139241153) is not available.
What is the SMILES notation for CID 139241153?
The canonical SMILES for CID 139241153 is CC(C)c1cccc(C(C)C)c1N1[C]N(c2c(C(C)C)cccc2C(C)C)CC1.Cl[Ru](Cl)=C1C=C(c2ccccc2)c2ccccc21.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 139241153?
The InChIKey is GZMFTHPVQNQPPT-UHFFFAOYSA-L. The full InChI is InChI=1S/C27H38N2.C18H15P.C15H10.2ClH.Ru/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)15;;;/h9-14,18-21H,15-16H2,1-8H3;1-15H;1-9,11H;2*1H;/q;;;;;+2/p-2.
What are the key properties of CID 139241153?
CID 139241153 has a molecular weight of 1015.13 g/mol, XLogP of 15.53, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139241153 is sourced from PubChem (CID 139241153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).