C38H40Cl2N3Ru- — CID 154612121
acetonitrile;1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-(3-phenylinden-1-ylidene)ruthenium (PubChem CID 154612121) has the molecular formula C38H40Cl2N3Ru- and a molecular weight of 710.74 g/mol. Its IUPAC name is acetonitrile;1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-(3-phenylinden-1-ylidene)ruthenium.
| Compound Name | acetonitrile;1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-(3-phenylinden-1-ylidene)ruthenium |
|---|---|
| PubChem CID | 154612121 |
| Molecular Formula | C38H40Cl2N3Ru- |
| Molecular Weight | 710.74 g/mol |
| Exact Mass | 710.16 |
| IUPAC Name | acetonitrile;1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-(3-phenylinden-1-ylidene)ruthenium |
| SMILES | CC#N.Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.Cl[Ru](Cl)=C1C=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H27N2.C15H10.C2H3N.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)15;1-2-3;;;/h9-13H,7-8H2,1-6H3;1-9,11H;1H3;2*1H;/q-1;;;;;+2/p-2 |
| InChIKey | KQBVPPMZMNIIJC-UHFFFAOYSA-L |
| XLogP | 10.09 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.74 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|