About CID 139253249
CID 139253249 (PubChem CID 139253249) has the molecular formula C39H45Cl2Cu2N2P
and a molecular weight of 770.78 g/mol.
Molecular Properties
| Compound Name | CID 139253249 |
| PubChem CID | 139253249 |
| Molecular Formula | C39H45Cl2Cu2N2P |
| Molecular Weight | 770.78 g/mol |
| Exact Mass | 768.13 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C]N(c2c(C(C)C)cccc2C(C)C)C(P(c2ccccc2)c2ccccc2)=C1.Cl[Cu].Cl[Cu] |
| InChI | InChI=1S/C39H45N2P.2ClH.2Cu/c1-27(2)33-21-15-22-34(28(3)4)38(33)40-25-37(42(31-17-11-9-12-18-31)32-19-13-10-14-20-32)41(26-40)39-35(29(5)6)23-16-24-36(39)30(7)8;;;;/h9-25,27-30H,1-8H3;2*1H;;/q;;;2*+1/p-2 |
| InChIKey | QNAMJWVHKGYSGV-UHFFFAOYSA-L |
| XLogP | 11.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 770.78 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 139253249 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139253249?
The IUPAC name of CID 139253249 (CID 139253249) is not available.
What is the SMILES notation for CID 139253249?
The canonical SMILES for CID 139253249 is CC(C)c1cccc(C(C)C)c1N1[C]N(c2c(C(C)C)cccc2C(C)C)C(P(c2ccccc2)c2ccccc2)=C1.Cl[Cu].Cl[Cu].
What is the InChIKey of CID 139253249?
The InChIKey is QNAMJWVHKGYSGV-UHFFFAOYSA-L. The full InChI is InChI=1S/C39H45N2P.2ClH.2Cu/c1-27(2)33-21-15-22-34(28(3)4)38(33)40-25-37(42(31-17-11-9-12-18-31)32-19-13-10-14-20-32)41(26-40)39-35(29(5)6)23-16-24-36(39)30(7)8;;;;/h9-25,27-30H,1-8H3;2*1H;;/q;;;2*+1/p-2.
What are the key properties of CID 139253249?
CID 139253249 has a molecular weight of 770.78 g/mol, XLogP of 11.81, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139253249 is sourced from PubChem (CID 139253249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).