C48H56N3P2+ — CID 139185972
bis[[2,6-di(propan-2-yl)anilino]-diphenyl-λ5-phosphanylidene]azanium (PubChem CID 139185972) has the molecular formula C48H56N3P2+ and a molecular weight of 736.95 g/mol. Its IUPAC name is bis[[2,6-di(propan-2-yl)anilino]-diphenyl-λ5-phosphanylidene]azanium.
| Compound Name | bis[[2,6-di(propan-2-yl)anilino]-diphenyl-λ5-phosphanylidene]azanium |
|---|---|
| PubChem CID | 139185972 |
| Molecular Formula | C48H56N3P2+ |
| Molecular Weight | 736.95 g/mol |
| Exact Mass | 736.39 |
| IUPAC Name | bis[[2,6-di(propan-2-yl)anilino]-diphenyl-λ5-phosphanylidene]azanium |
| SMILES | CC(C)c1cccc(C(C)C)c1NP(=[N+]=P(Nc1c(C(C)C)cccc1C(C)C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H55N3P2/c1-35(2)43-31-21-32-44(36(3)4)47(43)49-52(39-23-13-9-14-24-39,40-25-15-10-16-26-40)51-53(41-27-17-11-18-28-41,42-29-19-12-20-30-42)50-48-45(37(5)6)33-22-34-46(48)38(7)8/h9-38H,1-8H3,(H,49,50,51)/p+1 |
| InChIKey | ZFZRGMRAJHUBQO-UHFFFAOYSA-O |
| XLogP | 12.31 |
| TPSA | 38.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.95 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|