C20H26NO3P — CID 19764426
[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-phenylphosphinic acid (PubChem CID 19764426) has the molecular formula C20H26NO3P and a molecular weight of 359.41 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-phenylphosphinic acid.
| Compound Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-phenylphosphinic acid |
|---|---|
| PubChem CID | 19764426 |
| Molecular Formula | C20H26NO3P |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-phenylphosphinic acid |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CP(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C20H26NO3P/c1-14(2)17-11-8-12-18(15(3)4)20(17)21-19(22)13-25(23,24)16-9-6-5-7-10-16/h5-12,14-15H,13H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | MUHHNSIGDPZYIT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|