C16H25NO4P- — CID 86746778
[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-ethoxyphosphinate (PubChem CID 86746778) has the molecular formula C16H25NO4P- and a molecular weight of 326.35 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-ethoxyphosphinate.
| Compound Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-ethoxyphosphinate |
|---|---|
| PubChem CID | 86746778 |
| Molecular Formula | C16H25NO4P- |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-ethoxyphosphinate |
| SMILES | CCOP(=O)([O-])CC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C16H26NO4P/c1-6-21-22(19,20)10-15(18)17-16-13(11(2)3)8-7-9-14(16)12(4)5/h7-9,11-12H,6,10H2,1-5H3,(H,17,18)(H,19,20)/p-1 |
| InChIKey | QBAZYSSNMBQQPC-UHFFFAOYSA-M |
| XLogP | 3.46 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|