C15H14NO5P — CID 175183741
5-[anilino(methyl)phosphoryl]benzene-1,3-dicarboxylic acid (PubChem CID 175183741) has the molecular formula C15H14NO5P and a molecular weight of 319.25 g/mol. Its IUPAC name is 5-[anilino(methyl)phosphoryl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[anilino(methyl)phosphoryl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175183741 |
| Molecular Formula | C15H14NO5P |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 5-[anilino(methyl)phosphoryl]benzene-1,3-dicarboxylic acid |
| SMILES | CP(=O)(Nc1ccccc1)c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C15H14NO5P/c1-22(21,16-12-5-3-2-4-6-12)13-8-10(14(17)18)7-11(9-13)15(19)20/h2-9H,1H3,(H,16,21)(H,17,18)(H,19,20) |
| InChIKey | RXVBEYPEKIHVRC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|