C28H29N2O2P — CID 11213233
(1S,2S)-1-N-diphenylphosphoryl-1-(4-methoxyphenyl)-1-phenylpropane-1,2-diamine (PubChem CID 11213233) has the molecular formula C28H29N2O2P and a molecular weight of 456.53 g/mol. Its IUPAC name is (1S,2S)-1-N-diphenylphosphoryl-1-(4-methoxyphenyl)-1-phenylpropane-1,2-diamine.
| Compound Name | (1S,2S)-1-N-diphenylphosphoryl-1-(4-methoxyphenyl)-1-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 11213233 |
| Molecular Formula | C28H29N2O2P |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (1S,2S)-1-N-diphenylphosphoryl-1-(4-methoxyphenyl)-1-phenylpropane-1,2-diamine |
| SMILES | COc1ccc([C@@](NP(=O)(c2ccccc2)c2ccccc2)(c2ccccc2)[C@H](C)N)cc1 |
| InChI | InChI=1S/C28H29N2O2P/c1-22(29)28(23-12-6-3-7-13-23,24-18-20-25(32-2)21-19-24)30-33(31,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-22H,29H2,1-2H3,(H,30,31)/t22-,28-/m0/s1 |
| InChIKey | RWICGOPNEJPPQX-DWACAAAGSA-N |
| XLogP | 4.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|