C24H21BrNO2PS — CID 134948028
(2R)-2-[(1S)-1-(4-bromophenyl)-1-(diphenylphosphinothioylamino)ethyl]-2H-furan-5-one (PubChem CID 134948028) has the molecular formula C24H21BrNO2PS and a molecular weight of 498.38 g/mol. Its IUPAC name is (2R)-2-[(1S)-1-(4-bromophenyl)-1-(diphenylphosphinothioylamino)ethyl]-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S)-1-(4-bromophenyl)-1-(diphenylphosphinothioylamino)ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 134948028 |
| Molecular Formula | C24H21BrNO2PS |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | (2R)-2-[(1S)-1-(4-bromophenyl)-1-(diphenylphosphinothioylamino)ethyl]-2H-furan-5-one |
| SMILES | C[C@](NP(=S)(c1ccccc1)c1ccccc1)(c1ccc(Br)cc1)[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C24H21BrNO2PS/c1-24(22-16-17-23(27)28-22,18-12-14-19(25)15-13-18)26-29(30,20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-17,22H,1H3,(H,26,30)/t22-,24+/m1/s1 |
| InChIKey | PGTCXKDYGJPTQT-VWNXMTODSA-N |
| XLogP | 4.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|