C22H25NO3P2S — CID 74763188
(1R)-1-dimethoxyphosphoryl-N-diphenylphosphinothioyl-1-phenylethanamine (PubChem CID 74763188) has the molecular formula C22H25NO3P2S and a molecular weight of 445.46 g/mol. Its IUPAC name is (1R)-1-dimethoxyphosphoryl-N-diphenylphosphinothioyl-1-phenylethanamine.
| Compound Name | (1R)-1-dimethoxyphosphoryl-N-diphenylphosphinothioyl-1-phenylethanamine |
|---|---|
| PubChem CID | 74763188 |
| Molecular Formula | C22H25NO3P2S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (1R)-1-dimethoxyphosphoryl-N-diphenylphosphinothioyl-1-phenylethanamine |
| SMILES | COP(=O)(OC)[C@@](C)(NP(=S)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO3P2S/c1-22(28(24,25-2)26-3,19-13-7-4-8-14-19)23-27(29,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,1-3H3,(H,23,29)/t22-/m1/s1 |
| InChIKey | GYMJLEFDAIOMAC-JOCHJYFZSA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|