C24H21BrNO3PS — CID 46934011
methyl 2-[(2S,3R)-5-bromo-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]prop-2-enoate (PubChem CID 46934011) has the molecular formula C24H21BrNO3PS and a molecular weight of 514.38 g/mol. Its IUPAC name is methyl 2-[(2S,3R)-5-bromo-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2S,3R)-5-bromo-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 46934011 |
| Molecular Formula | C24H21BrNO3PS |
| Molecular Weight | 514.38 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | methyl 2-[(2S,3R)-5-bromo-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1Oc2ccc(Br)cc2[C@H]1NP(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21BrNO3PS/c1-16(24(27)28-2)23-22(20-15-17(25)13-14-21(20)29-23)26-30(31,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15,22-23H,1H2,2H3,(H,26,31)/t22-,23+/m1/s1 |
| InChIKey | ZZXJHQOLPVNXNI-PKTZIBPZSA-N |
| XLogP | 4.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|