C26H25BrNO3PS — CID 102284294
ethyl (E)-3-[6-bromo-4-(diphenylphosphinothioylamino)-3,4-dihydro-2H-chromen-2-yl]prop-2-enoate (PubChem CID 102284294) has the molecular formula C26H25BrNO3PS and a molecular weight of 542.44 g/mol. Its IUPAC name is ethyl (E)-3-[6-bromo-4-(diphenylphosphinothioylamino)-3,4-dihydro-2H-chromen-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[6-bromo-4-(diphenylphosphinothioylamino)-3,4-dihydro-2H-chromen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102284294 |
| Molecular Formula | C26H25BrNO3PS |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | ethyl (E)-3-[6-bromo-4-(diphenylphosphinothioylamino)-3,4-dihydro-2H-chromen-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1CC(NP(=S)(c2ccccc2)c2ccccc2)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C26H25BrNO3PS/c1-2-30-26(29)16-14-20-18-24(23-17-19(27)13-15-25(23)31-20)28-32(33,21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-17,20,24H,2,18H2,1H3,(H,28,33)/b16-14+ |
| InChIKey | NWFHVZBFJBFJQV-JQIJEIRASA-N |
| XLogP | 5.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|