About 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea
1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea (PubChem CID 70238342) has the molecular formula C18H17BrN2O2
and a molecular weight of 373.25 g/mol. Its IUPAC name is 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea.
Molecular Properties
| Compound Name | 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea |
| PubChem CID | 70238342 |
| Molecular Formula | C18H17BrN2O2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea |
| SMILES | C=CNC(=O)NC1CC(c2ccccc2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C18H17BrN2O2/c1-2-20-18(22)21-15-11-17(12-6-4-3-5-7-12)23-16-9-8-13(19)10-14(15)16/h2-10,15,17H,1,11H2,(H2,20,21,22) |
| InChIKey | UHJJWUXBSBQRMD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea?
The IUPAC name of 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea (CID 70238342) is 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea.
What is the SMILES notation for 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea?
The canonical SMILES for 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea is C=CNC(=O)NC1CC(c2ccccc2)Oc2ccc(Br)cc21.
What is the InChIKey of 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea?
The InChIKey is UHJJWUXBSBQRMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrN2O2/c1-2-20-18(22)21-15-11-17(12-6-4-3-5-7-12)23-16-9-8-13(19)10-14(15)16/h2-10,15,17H,1,11H2,(H2,20,21,22).
What are the key properties of 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea?
1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea has a molecular weight of 373.25 g/mol, XLogP of 4.46, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-2-phenyl-3,4-dihydro-2H-chromen-4-yl)-3-ethenylurea is sourced from PubChem (CID 70238342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).