C33H40NO3PS — CID 25191800
ethyl (E)-3-[(2R,3R)-5,7-ditert-butyl-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]prop-2-enoate (PubChem CID 25191800) has the molecular formula C33H40NO3PS and a molecular weight of 561.73 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,3R)-5,7-ditert-butyl-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,3R)-5,7-ditert-butyl-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 25191800 |
| Molecular Formula | C33H40NO3PS |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | ethyl (E)-3-[(2R,3R)-5,7-ditert-butyl-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1Oc2c(cc(C(C)(C)C)cc2C(C)(C)C)[C@H]1NP(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H40NO3PS/c1-8-36-29(35)20-19-28-30(26-21-23(32(2,3)4)22-27(31(26)37-28)33(5,6)7)34-38(39,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-22,28,30H,8H2,1-7H3,(H,34,39)/b20-19+/t28-,30-/m1/s1 |
| InChIKey | QRFJQIKORGQXSN-FMXUKPFYSA-N |
| XLogP | 6.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|