C24H21ClNO3PS — CID 54753176
methyl (E)-3-[(2S,3R)-7-chloro-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]prop-2-enoate (PubChem CID 54753176) has the molecular formula C24H21ClNO3PS and a molecular weight of 469.93 g/mol. Its IUPAC name is methyl (E)-3-[(2S,3R)-7-chloro-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2S,3R)-7-chloro-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 54753176 |
| Molecular Formula | C24H21ClNO3PS |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | methyl (E)-3-[(2S,3R)-7-chloro-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1Oc2c(Cl)cccc2[C@H]1NP(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21ClNO3PS/c1-28-22(27)16-15-21-23(19-13-8-14-20(25)24(19)29-21)26-30(31,17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-16,21,23H,1H3,(H,26,31)/b16-15+/t21-,23+/m0/s1 |
| InChIKey | DCIRCSZCLTZTBU-YKBCBSFJSA-N |
| XLogP | 4.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|