C25H19ClNO2PS2 — CID 54751780
[(2R,3R)-7-chloro-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]-thiophen-2-ylmethanone (PubChem CID 54751780) has the molecular formula C25H19ClNO2PS2 and a molecular weight of 495.99 g/mol. Its IUPAC name is [(2R,3R)-7-chloro-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]-thiophen-2-ylmethanone.
| Compound Name | [(2R,3R)-7-chloro-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 54751780 |
| Molecular Formula | C25H19ClNO2PS2 |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | [(2R,3R)-7-chloro-3-(diphenylphosphinothioylamino)-2,3-dihydro-1-benzofuran-2-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)[C@@H]1Oc2c(Cl)cccc2[C@H]1NP(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H19ClNO2PS2/c26-20-14-7-13-19-22(25(29-24(19)20)23(28)21-15-8-16-32-21)27-30(31,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-16,22,25H,(H,27,31)/t22-,25-/m1/s1 |
| InChIKey | VGXHAMZZROPBKK-RCZVLFRGSA-N |
| XLogP | 5.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|