C15H16ClNO2S — CID 66925891
(2S)-2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)propanoic acid (PubChem CID 66925891) has the molecular formula C15H16ClNO2S and a molecular weight of 309.82 g/mol. Its IUPAC name is (2S)-2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)propanoic acid.
| Compound Name | (2S)-2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)propanoic acid |
|---|---|
| PubChem CID | 66925891 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (2S)-2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)propanoic acid |
| SMILES | C[C@@](NCCc1cccs1)(C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C15H16ClNO2S/c1-15(14(18)19,12-6-2-3-7-13(12)16)17-9-8-11-5-4-10-20-11/h2-7,10,17H,8-9H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | FQGRUDPKXRQARQ-HNNXBMFYSA-N |
| XLogP | 3.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |