C15H15ClNO2S- — CID 53437074
2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)propanoate (PubChem CID 53437074) has the molecular formula C15H15ClNO2S- and a molecular weight of 308.81 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)propanoate.
| Compound Name | 2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)propanoate |
|---|---|
| PubChem CID | 53437074 |
| Molecular Formula | C15H15ClNO2S- |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)propanoate |
| SMILES | CC(NCCc1cccs1)(C(=O)[O-])c1ccccc1Cl |
| InChI | InChI=1S/C15H16ClNO2S/c1-15(14(18)19,12-6-2-3-7-13(12)16)17-9-8-11-5-4-10-20-11/h2-7,10,17H,8-9H2,1H3,(H,18,19)/p-1 |
| InChIKey | FQGRUDPKXRQARQ-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |