C15H16ClNO2S — CID 21187056
(2-thiophen-2-ylethylamino) 2-(2-chlorophenyl)propanoate (PubChem CID 21187056) has the molecular formula C15H16ClNO2S and a molecular weight of 309.82 g/mol. Its IUPAC name is (2-thiophen-2-ylethylamino) 2-(2-chlorophenyl)propanoate.
| Compound Name | (2-thiophen-2-ylethylamino) 2-(2-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 21187056 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (2-thiophen-2-ylethylamino) 2-(2-chlorophenyl)propanoate |
| SMILES | CC(C(=O)ONCCc1cccs1)c1ccccc1Cl |
| InChI | InChI=1S/C15H16ClNO2S/c1-11(13-6-2-3-7-14(13)16)15(18)19-17-9-8-12-5-4-10-20-12/h2-7,10-11,17H,8-9H2,1H3 |
| InChIKey | XWECUWRMMIRFQY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|