C29H26NO3PS — CID 54753354
ethyl (2S,3R)-3-(diphenylphosphinothioylamino)-7-phenyl-2,3-dihydro-1-benzofuran-2-carboxylate (PubChem CID 54753354) has the molecular formula C29H26NO3PS and a molecular weight of 499.57 g/mol. Its IUPAC name is ethyl (2S,3R)-3-(diphenylphosphinothioylamino)-7-phenyl-2,3-dihydro-1-benzofuran-2-carboxylate.
| Compound Name | ethyl (2S,3R)-3-(diphenylphosphinothioylamino)-7-phenyl-2,3-dihydro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 54753354 |
| Molecular Formula | C29H26NO3PS |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | ethyl (2S,3R)-3-(diphenylphosphinothioylamino)-7-phenyl-2,3-dihydro-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1Oc2c(-c3ccccc3)cccc2[C@H]1NP(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26NO3PS/c1-2-32-29(31)28-26(25-20-12-19-24(27(25)33-28)21-13-6-3-7-14-21)30-34(35,22-15-8-4-9-16-22)23-17-10-5-11-18-23/h3-20,26,28H,2H2,1H3,(H,30,35)/t26-,28+/m1/s1 |
| InChIKey | NMFGBOJUJGPSOU-IAPPQJPRSA-N |
| XLogP | 5.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|