C18H13BrN2O2 — CID 89128193
(E)-N-(5-bromo-2-cyano-2,3-dihydro-1-benzofuran-3-yl)-3-phenylprop-2-enamide (PubChem CID 89128193) has the molecular formula C18H13BrN2O2 and a molecular weight of 369.22 g/mol. Its IUPAC name is (E)-N-(5-bromo-2-cyano-2,3-dihydro-1-benzofuran-3-yl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(5-bromo-2-cyano-2,3-dihydro-1-benzofuran-3-yl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 89128193 |
| Molecular Formula | C18H13BrN2O2 |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | (E)-N-(5-bromo-2-cyano-2,3-dihydro-1-benzofuran-3-yl)-3-phenylprop-2-enamide |
| SMILES | N#CC1Oc2ccc(Br)cc2C1NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H13BrN2O2/c19-13-7-8-15-14(10-13)18(16(11-20)23-15)21-17(22)9-6-12-4-2-1-3-5-12/h1-10,16,18H,(H,21,22)/b9-6+ |
| InChIKey | PNFMOIPHDQYHEJ-RMKNXTFCSA-N |
| XLogP | 3.60 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|