C18H24N4 — CID 71198711
2,4-diamino-N,N'-bis(4-methylphenyl)butanimidamide (PubChem CID 71198711) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 2,4-diamino-N,N'-bis(4-methylphenyl)butanimidamide.
| Compound Name | 2,4-diamino-N,N'-bis(4-methylphenyl)butanimidamide |
|---|---|
| PubChem CID | 71198711 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2,4-diamino-N,N'-bis(4-methylphenyl)butanimidamide |
| SMILES | Cc1ccc(/N=C(/Nc2ccc(C)cc2)C(N)CCN)cc1 |
| InChI | InChI=1S/C18H24N4/c1-13-3-7-15(8-4-13)21-18(17(20)11-12-19)22-16-9-5-14(2)6-10-16/h3-10,17H,11-12,19-20H2,1-2H3,(H,21,22) |
| InChIKey | CXHNRZQRQPXIPO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|