C23H26ClF3N2O4S2 — CID 163934075
tert-butyl 4-[4-[2-chloro-4-(sulfanylamino)-6-(trifluoromethyl)phenyl]phenyl]sulfonylpiperidine-1-carboxylate (PubChem CID 163934075) has the molecular formula C23H26ClF3N2O4S2 and a molecular weight of 551.05 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-chloro-4-(sulfanylamino)-6-(trifluoromethyl)phenyl]phenyl]sulfonylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-chloro-4-(sulfanylamino)-6-(trifluoromethyl)phenyl]phenyl]sulfonylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 163934075 |
| Molecular Formula | C23H26ClF3N2O4S2 |
| Molecular Weight | 551.05 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | tert-butyl 4-[4-[2-chloro-4-(sulfanylamino)-6-(trifluoromethyl)phenyl]phenyl]sulfonylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)(=O)c2ccc(-c3c(Cl)cc(NS)cc3C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H26ClF3N2O4S2/c1-22(2,3)33-21(30)29-10-8-17(9-11-29)35(31,32)16-6-4-14(5-7-16)20-18(23(25,26)27)12-15(28-34)13-19(20)24/h4-7,12-13,17,28,34H,8-11H2,1-3H3 |
| InChIKey | RLEIWPJDCMDXAW-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.05 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|