C25H37N3O4S — CID 142200925
tert-butyl 4-[3-[1-(4-cyanophenyl)sulfonylpiperidin-4-yl]propyl]piperidine-1-carboxylate (PubChem CID 142200925) has the molecular formula C25H37N3O4S and a molecular weight of 475.66 g/mol. Its IUPAC name is tert-butyl 4-[3-[1-(4-cyanophenyl)sulfonylpiperidin-4-yl]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[1-(4-cyanophenyl)sulfonylpiperidin-4-yl]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142200925 |
| Molecular Formula | C25H37N3O4S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | tert-butyl 4-[3-[1-(4-cyanophenyl)sulfonylpiperidin-4-yl]propyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCC2CCN(S(=O)(=O)c3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H37N3O4S/c1-25(2,3)32-24(29)27-15-11-20(12-16-27)5-4-6-21-13-17-28(18-14-21)33(30,31)23-9-7-22(19-26)8-10-23/h7-10,20-21H,4-6,11-18H2,1-3H3 |
| InChIKey | KCNWIJMLGSJDSB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |