C18H23FN2O4 — CID 121409483
tert-butyl 4-(2-cyano-3-fluoro-5-methoxyphenoxy)piperidine-1-carboxylate (PubChem CID 121409483) has the molecular formula C18H23FN2O4 and a molecular weight of 350.39 g/mol. Its IUPAC name is tert-butyl 4-(2-cyano-3-fluoro-5-methoxyphenoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-cyano-3-fluoro-5-methoxyphenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 121409483 |
| Molecular Formula | C18H23FN2O4 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | tert-butyl 4-(2-cyano-3-fluoro-5-methoxyphenoxy)piperidine-1-carboxylate |
| SMILES | COc1cc(F)c(C#N)c(OC2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C18H23FN2O4/c1-18(2,3)25-17(22)21-7-5-12(6-8-21)24-16-10-13(23-4)9-15(19)14(16)11-20/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | YDLHRZFUQPLSDY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |