C20H26N2O3 — CID 90291639
tert-butyl 4-[4-cyano-3-[(E)-prop-1-enyl]phenoxy]piperidine-1-carboxylate (PubChem CID 90291639) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is tert-butyl 4-[4-cyano-3-[(E)-prop-1-enyl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-cyano-3-[(E)-prop-1-enyl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90291639 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | tert-butyl 4-[4-cyano-3-[(E)-prop-1-enyl]phenoxy]piperidine-1-carboxylate |
| SMILES | C/C=C/c1cc(OC2CCN(C(=O)OC(C)(C)C)CC2)ccc1C#N |
| InChI | InChI=1S/C20H26N2O3/c1-5-6-15-13-18(8-7-16(15)14-21)24-17-9-11-22(12-10-17)19(23)25-20(2,3)4/h5-8,13,17H,9-12H2,1-4H3/b6-5+ |
| InChIKey | FGQCPYLFSLIXDM-AATRIKPKSA-N |
| XLogP | 4.37 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |