C23H31N3O3 — CID 71502739
tert-butyl 4-[4-cyano-3-[(E)-2-pyrrolidin-1-ylethenyl]phenoxy]piperidine-1-carboxylate (PubChem CID 71502739) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl 4-[4-cyano-3-[(E)-2-pyrrolidin-1-ylethenyl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-cyano-3-[(E)-2-pyrrolidin-1-ylethenyl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71502739 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | tert-butyl 4-[4-cyano-3-[(E)-2-pyrrolidin-1-ylethenyl]phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(C#N)c(/C=C/N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C23H31N3O3/c1-23(2,3)29-22(27)26-14-9-20(10-15-26)28-21-7-6-19(17-24)18(16-21)8-13-25-11-4-5-12-25/h6-8,13,16,20H,4-5,9-12,14-15H2,1-3H3/b13-8+ |
| InChIKey | FZXQFLYRDPOSKF-MDWZMJQESA-N |
| XLogP | 4.40 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |