C23H31FN2O7 — CID 168568007
dimethyl (E)-2-[5-fluoro-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]anilino]but-2-enedioate (PubChem CID 168568007) has the molecular formula C23H31FN2O7 and a molecular weight of 466.51 g/mol. Its IUPAC name is dimethyl (E)-2-[5-fluoro-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[5-fluoro-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568007 |
| Molecular Formula | C23H31FN2O7 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | dimethyl (E)-2-[5-fluoro-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(F)ccc1OCC1CCN(C(=O)OC(C)(C)C)CC1)C(=O)OC |
| InChI | InChI=1S/C23H31FN2O7/c1-23(2,3)33-22(29)26-10-8-15(9-11-26)14-32-19-7-6-16(24)12-17(19)25-18(21(28)31-5)13-20(27)30-4/h6-7,12-13,15,25H,8-11,14H2,1-5H3/b18-13+ |
| InChIKey | FBLXIXVYDVYIOT-QGOAFFKASA-N |
| XLogP | 3.49 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|