C20H28FNO5 — CID 130475928
tert-butyl 4-[[2-fluoro-4-(2-methoxy-2-oxoethyl)phenoxy]methyl]piperidine-1-carboxylate (PubChem CID 130475928) has the molecular formula C20H28FNO5 and a molecular weight of 381.44 g/mol. Its IUPAC name is tert-butyl 4-[[2-fluoro-4-(2-methoxy-2-oxoethyl)phenoxy]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-fluoro-4-(2-methoxy-2-oxoethyl)phenoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 130475928 |
| Molecular Formula | C20H28FNO5 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | tert-butyl 4-[[2-fluoro-4-(2-methoxy-2-oxoethyl)phenoxy]methyl]piperidine-1-carboxylate |
| SMILES | COC(=O)Cc1ccc(OCC2CCN(C(=O)OC(C)(C)C)CC2)c(F)c1 |
| InChI | InChI=1S/C20H28FNO5/c1-20(2,3)27-19(24)22-9-7-14(8-10-22)13-26-17-6-5-15(11-16(17)21)12-18(23)25-4/h5-6,11,14H,7-10,12-13H2,1-4H3 |
| InChIKey | FJAALELVPFWKFH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |