C24H30FNO5S — CID 24993711
tert-butyl 4-[[2-fluoro-4-(4-methylsulfonylphenyl)phenoxy]methyl]piperidine-1-carboxylate (PubChem CID 24993711) has the molecular formula C24H30FNO5S and a molecular weight of 463.57 g/mol. Its IUPAC name is tert-butyl 4-[[2-fluoro-4-(4-methylsulfonylphenyl)phenoxy]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-fluoro-4-(4-methylsulfonylphenyl)phenoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24993711 |
| Molecular Formula | C24H30FNO5S |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | tert-butyl 4-[[2-fluoro-4-(4-methylsulfonylphenyl)phenoxy]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COc2ccc(-c3ccc(S(C)(=O)=O)cc3)cc2F)CC1 |
| InChI | InChI=1S/C24H30FNO5S/c1-24(2,3)31-23(27)26-13-11-17(12-14-26)16-30-22-10-7-19(15-21(22)25)18-5-8-20(9-6-18)32(4,28)29/h5-10,15,17H,11-14,16H2,1-4H3 |
| InChIKey | GDOWLEVMGIPYDZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |